ChemNet > CAS > 20780-76-1 5-Iodoisatin
20780-76-1 5-Iodoisatin
| 상품명칭 |
5-Iodoisatin |
| 별명 |
5-Iodo-1H-indole-2,3-dione; NSC 92515; Iodoisatin, 5- |
| 분자식 |
C8H4INO2 |
| 분자량 |
273.0273 |
| InChI |
InChI=1/C8H4INO2/c9-4-1-2-6-5(3-4)7(11)8(12)10-6/h1-3H,(H,10,11,12) |
| cas번호 |
20780-76-1 |
| EC번호 |
244-035-1 |
| 분자 구조 |
|
| 밀도 |
2.106g/cm3 |
| 녹는 점 |
276-278℃ |
| 굴절 지수 |
1.704 |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
