ChemNet > CAS > 207919-09-3 2,3,4-trifluorobenzamide
207919-09-3 2,3,4-trifluorobenzamide
| 상품명칭 |
2,3,4-trifluorobenzamide |
| 별명 |
Trifluorobenzamide1 |
| 분자식 |
C7H4F3NO |
| 분자량 |
175.108 |
| InChI |
InChI=1/C7H4F3NO/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2H,(H2,11,12) |
| cas번호 |
207919-09-3 |
| 분자 구조 |
|
| 밀도 |
1.45g/cm3 |
| 녹는 점 |
127-129℃ |
| 비등점 |
166°C at 760 mmHg |
| 굴절 지수 |
1.494 |
| 인화점 |
54.2°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
