ChemNet > CAS > 208173-21-1 4-fluoro-2-(trifluoromethyl)acetophenone
208173-21-1 4-fluoro-2-(trifluoromethyl)acetophenone
| 상품명칭 |
4-fluoro-2-(trifluoromethyl)acetophenone |
| 별명 |
4'-fluoro-2'-(trifluoromethyl)acetophenone; 1-[4-fluoro-2-(trifluoromethyl)phenyl]ethanone; 4'-Fluoro-2'-trifluoromethylacetophenone; 4-Fluoro-2-trifluoromethylacetophenone |
| 분자식 |
C9H9FO2 |
| 분자량 |
168.165 |
| InChI |
InChI=1/C9H9FO2/c1-6(11)7-3-4-8(10)9(5-7)12-2/h3-5H,1-2H3 |
| cas번호 |
208173-21-1 |
| 분자 구조 |
|
| 밀도 |
1.127g/cm3 |
| 비등점 |
246°C at 760 mmHg |
| 굴절 지수 |
1.487 |
| 인화점 |
99.6°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
