ChemNet > CAS > 2083-09-2 2,5-Bis(4-biphenylyl)oxazole
2083-09-2 2,5-Bis(4-biphenylyl)oxazole
상품명칭 |
2,5-Bis(4-biphenylyl)oxazole |
별명 |
2,5-di(biphenyl-4-yl)oxazole; 2,5-Bis(4-biphenyl)oxazole; BBO; 2,5-di(biphenyl-4-yl)-1,3-oxazole |
분자식 |
C27H19NO |
분자량 |
373.4459 |
InChI |
InChI=1/C27H19NO/c1-3-7-20(8-4-1)22-11-15-24(16-12-22)26-19-28-27(29-26)25-17-13-23(14-18-25)21-9-5-2-6-10-21/h1-19H |
cas번호 |
2083-09-2 |
EC번호 |
218-220-2 |
분자 구조 |
|
밀도 |
1.143g/cm3 |
녹는 점 |
238-240℃ |
비등점 |
592.4°C at 760 mmHg |
굴절 지수 |
1.621 |
인화점 |
259.6°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|