ChemNet > CAS > 20850-43-5 5-(chloromethyl)-1,3-benzodioxole
20850-43-5 5-(chloromethyl)-1,3-benzodioxole
상품명칭 |
5-(chloromethyl)-1,3-benzodioxole |
별명 |
3,4-Methylenedioxybenzyl chloride; 5-chloro-1,3-benzodioxole; Piperonal chloride |
분자식 |
C7H5ClO2 |
분자량 |
156.5664 |
InChI |
InChI=1/C7H5ClO2/c8-5-1-2-6-7(3-5)10-4-9-6/h1-3H,4H2 |
cas번호 |
20850-43-5 |
EC번호 |
244-081-2 |
분자 구조 |
|
밀도 |
1.39g/cm3 |
비등점 |
186°C at 760 mmHg |
굴절 지수 |
1.577 |
인화점 |
93.9°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|