ChemNet > CAS > 21298-53-3 3-(2-Thienyl)pyridine
21298-53-3 3-(2-Thienyl)pyridine
상품명칭 |
3-(2-Thienyl)pyridine |
별명 |
2-(3-Pyridyl)thiophene; 3-(thiophen-2-yl)pyridine |
분자식 |
C9H7NS |
분자량 |
161.2236 |
InChI |
InChI=1/C9H7NS/c1-3-8(7-10-5-1)9-4-2-6-11-9/h1-7H |
cas번호 |
21298-53-3 |
분자 구조 |
|
밀도 |
1.173g/cm3 |
비등점 |
278.6°C at 760 mmHg |
굴절 지수 |
1.604 |
인화점 |
121.8°C |
위험성 표시 |
|
리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|