ChemNet > CAS > 21331-43-1 2-Amino-4-(2-naphthyl)thiazole
21331-43-1 2-Amino-4-(2-naphthyl)thiazole
상품명칭 |
2-Amino-4-(2-naphthyl)thiazole |
별명 |
4-(2-Naphthyl)-2-thiazolamine; 4-(naphthalen-2-yl)-1,3-thiazol-2-amine |
분자식 |
C13H10N2S |
분자량 |
226.2969 |
InChI |
InChI=1/C13H10N2S/c14-13-15-12(8-16-13)11-6-5-9-3-1-2-4-10(9)7-11/h1-8H,(H2,14,15) |
cas번호 |
21331-43-1 |
분자 구조 |
|
밀도 |
1.301g/cm3 |
녹는 점 |
153-155℃ |
비등점 |
443.9°C at 760 mmHg |
굴절 지수 |
1.73 |
인화점 |
222.3°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|