ChemNet > CAS > 2145-31-5 3-(trifluoromethyl)phenoxyacetonitrile
2145-31-5 3-(trifluoromethyl)phenoxyacetonitrile
상품명칭 |
3-(trifluoromethyl)phenoxyacetonitrile |
별명 |
2-[3-(Trifluoromethyl)phenoxy]acetonitrile; methyl 4-fluoro-3-hydroxybenzoate |
분자식 |
C8H7FO3 |
분자량 |
170.1378 |
InChI |
InChI=1/C8H7FO3/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4,10H,1H3 |
cas번호 |
2145-31-5 |
분자 구조 |
|
밀도 |
1.309g/cm3 |
비등점 |
268.9°C at 760 mmHg |
굴절 지수 |
1.526 |
인화점 |
116.4°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|