ChemNet > CAS > 215-58-7 1,2,3,4-Dibenzanthracene
215-58-7 1,2,3,4-Dibenzanthracene
상품명칭 |
1,2,3,4-Dibenzanthracene |
별명 |
Dibenz[a,c]anthracene; dibenz(a,c)anthracene; 1,2:3,4-dibenzanthracene; Benztriphenylene; 2,3-Benztriphenylene; benzo[f]tetraphene |
분자식 |
C22H14 |
분자량 |
278.3466 |
InChI |
InChI=1/C22H14/c1-2-8-16-14-22-20-12-6-4-10-18(20)17-9-3-5-11-19(17)21(22)13-15(16)7-1/h1-14H |
cas번호 |
215-58-7 |
EC번호 |
205-920-8 |
분자 구조 |
|
밀도 |
1.232g/cm3 |
녹는 점 |
202-207℃ |
비등점 |
518°C at 760 mmHg |
굴절 지수 |
1.811 |
인화점 |
264.5°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R40:Possible risks of irreversible effects.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|