ChemNet > CAS > 21557-09-5 4-(1-Pyrrolidino)acetophenone
21557-09-5 4-(1-Pyrrolidino)acetophenone
| 상품명칭 |
4-(1-Pyrrolidino)acetophenone |
| 별명 |
1-[4-(pyrrolidin-1-yl)phenyl]ethanone |
| 분자식 |
C12H15NO |
| 분자량 |
189.2536 |
| InChI |
InChI=1/C12H15NO/c1-10(14)11-4-6-12(7-5-11)13-8-2-3-9-13/h4-7H,2-3,8-9H2,1H3 |
| cas번호 |
21557-09-5 |
| 분자 구조 |
|
| 밀도 |
1.078g/cm3 |
| 비등점 |
342.7°C at 760 mmHg |
| 굴절 지수 |
1.556 |
| 인화점 |
136.5°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
