ChemNet > CAS > 2160-94-3 3-Cyclohexene-1,1-dimethanol
2160-94-3 3-Cyclohexene-1,1-dimethanol
상품명칭 |
3-Cyclohexene-1,1-dimethanol |
별명 |
4,4-Bis(hydroxymethyl)-1-cyclohexene; cyclohex-3-ene-1,1-diyldimethanol |
분자식 |
C8H14O2 |
분자량 |
142.1956 |
InChI |
InChI=1/C8H14O2/c9-6-8(7-10)4-2-1-3-5-8/h1-2,9-10H,3-7H2 |
cas번호 |
2160-94-3 |
EC번호 |
218-481-2 |
분자 구조 |
|
밀도 |
1.05g/cm3 |
녹는 점 |
88-92℃ |
비등점 |
231.2°C at 760 mmHg |
굴절 지수 |
1.497 |
인화점 |
105°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|