ChemNet > CAS > 216393-55-4 Methyl 3,5-difluorobenzoate
216393-55-4 Methyl 3,5-difluorobenzoate
상품명칭 |
Methyl 3,5-difluorobenzoate |
별명 |
3,5-Difluorobenzoic acid methyl ester |
분자식 |
C8H6F2O2 |
분자량 |
172.1288 |
InChI |
InChI=1/C8H6F2O2/c1-12-8(11)5-2-6(9)4-7(10)3-5/h2-4H,1H3 |
cas번호 |
216393-55-4 |
분자 구조 |
|
밀도 |
1.268g/cm3 |
비등점 |
202.7°C at 760 mmHg |
굴절 지수 |
1.472 |
인화점 |
74.6°C |
위험성 표시 |
|
리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|