ChemNet > CAS > 2174-64-3 3,5-dihydroxyanisole
2174-64-3 3,5-dihydroxyanisole
상품명칭 |
3,5-dihydroxyanisole |
별명 |
5-Methoxyresorcinol; Flamenol; ; 5-methoxybenzene-1,3-diol; 3,5-Dihydroxyanisole Hydrate |
분자식 |
C7H8O3 |
분자량 |
140.1366 |
InChI |
InChI=1/C7H8O3/c1-10-7-3-5(8)2-6(9)4-7/h2-4,8-9H,1H3 |
cas번호 |
2174-64-3 |
EC번호 |
218-532-9 |
분자 구조 |
|
밀도 |
1.27g/cm3 |
녹는 점 |
76--85℃ |
비등점 |
326.4°C at 760 mmHg |
굴절 지수 |
1.579 |
인화점 |
122.5°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|