ChemNet > CAS > 21901-34-8 2-Hydroxy-5-nitro-3-picoline
21901-34-8 2-Hydroxy-5-nitro-3-picoline
상품명칭 |
2-Hydroxy-5-nitro-3-picoline |
별명 |
3-Methyl-5-nitro-2-pyridone; 3-Methyl-5-nitro-2-pyridinol; 2-Hydroxy-3-methyl-5-nitropyridine; 3-methyl-5-nitropyridin-2(1H)-one; 3-methyl-5-nitropyridin-2-ol |
분자식 |
C6H6N2O3 |
분자량 |
154.1234 |
InChI |
InChI=1/C6H6N2O3/c1-4-2-5(8(10)11)3-7-6(4)9/h2-3H,1H3,(H,7,9) |
cas번호 |
21901-34-8 |
EC번호 |
244-647-9 |
분자 구조 |
|
밀도 |
1.36g/cm3 |
비등점 |
327.2°C at 760 mmHg |
굴절 지수 |
1.567 |
인화점 |
151.7°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|