ChemNet > CAS > 2196-13-6 Thioisonicotinamide
2196-13-6 Thioisonicotinamide
상품명칭 |
Thioisonicotinamide |
별명 |
isonicotinthioamide; Isothionicotinamide; Pyridine-4-thiocarboxamide; pyridine-4-carbothioamide |
분자식 |
C6H6N2S |
분자량 |
138.1902 |
InChI |
InChI=1/C6H6N2S/c7-6(9)5-1-3-8-4-2-5/h1-4H,(H2,7,9) |
cas번호 |
2196-13-6 |
EC번호 |
218-592-6 |
분자 구조 |
|
밀도 |
1.265g/cm3 |
녹는 점 |
198-202℃ |
비등점 |
278.9°C at 760 mmHg |
굴절 지수 |
1.664 |
인화점 |
122.5°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|