ChemNet > CAS > 22424-58-4 5-Benzyloxy-2-nitrotoluene
22424-58-4 5-Benzyloxy-2-nitrotoluene
상품명칭 |
5-Benzyloxy-2-nitrotoluene |
별명 |
5-(Benzyloxy)-2-nitrotoluene; 1-(benzyloxy)-2-methyl-4-nitrobenzene; 4-(benzyloxy)-2-methyl-1-nitrobenzene |
분자식 |
C14H13NO3 |
분자량 |
243.2579 |
InChI |
InChI=1/C14H13NO3/c1-11-9-13(7-8-14(11)15(16)17)18-10-12-5-3-2-4-6-12/h2-9H,10H2,1H3 |
cas번호 |
22424-58-4 |
EC번호 |
244-988-3 |
분자 구조 |
|
밀도 |
1.202g/cm3 |
비등점 |
398.5°C at 760 mmHg |
굴절 지수 |
1.595 |
인화점 |
175.7°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|