ChemNet > CAS > 2265-91-0 1,3-Difluoro-5-iodobenzene
2265-91-0 1,3-Difluoro-5-iodobenzene
| 상품명칭 |
1,3-Difluoro-5-iodobenzene |
| 별명 |
3,5-DIFLUOROIODOBENZENE; 3,5-Difluoro iodobenzene |
| 분자식 |
C6H3F2I |
| 분자량 |
239.9893 |
| InChI |
InChI=1/C6H3F2I/c7-4-1-5(8)3-6(9)2-4/h1-3H |
| cas번호 |
2265-91-0 |
| 분자 구조 |
|
| 밀도 |
2.001g/cm3 |
| 비등점 |
173.9°C at 760 mmHg |
| 굴절 지수 |
1.566 |
| 인화점 |
63.8°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
