ChemNet > CAS > 229-87-8 Phenanthridine
229-87-8 Phenanthridine
상품명칭 |
Phenanthridine |
별명 |
Phenanthridine; 3,4-Benzoquinoline; Phenanthridine, (Benzo[c]quinoline) |
분자식 |
C13H9N |
분자량 |
179.2173 |
InChI |
InChI=1/C13H9N/c1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12/h1-9H |
cas번호 |
229-87-8 |
EC번호 |
205-934-4 |
분자 구조 |
|
밀도 |
1.187g/cm3 |
녹는 점 |
104-107℃ |
비등점 |
340.8°C at 760 mmHg |
굴절 지수 |
1.726 |
인화점 |
155.9°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R40:Possible risks of irreversible effects.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|