ChemNet > CAS > 23351-07-7 1-(4-Cyanophenyl)-pyrrole
23351-07-7 1-(4-Cyanophenyl)-pyrrole
상품명칭 |
1-(4-Cyanophenyl)-pyrrole |
별명 |
4-(1H-Pyrrol-1-yl)benzonitrile |
분자식 |
C11H8N2 |
분자량 |
168.1946 |
InChI |
InChI=1/C11H8N2/c12-9-10-3-5-11(6-4-10)13-7-1-2-8-13/h1-8H |
cas번호 |
23351-07-7 |
분자 구조 |
|
밀도 |
1.05g/cm3 |
비등점 |
312.8°C at 760 mmHg |
굴절 지수 |
1.589 |
인화점 |
143°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|