ChemNet > CAS > 2338-71-8 5-fluoroindole-3-carboxaldehyde
2338-71-8 5-fluoroindole-3-carboxaldehyde
상품명칭 |
5-fluoroindole-3-carboxaldehyde |
별명 |
5-Fluoro-3-formylindole; 5-fluoro-1H-indole-3-carbaldehyde |
분자식 |
C9H6FNO |
분자량 |
163.1484 |
InChI |
InChI=1/C9H6FNO/c10-7-1-2-9-8(3-7)6(5-12)4-11-9/h1-5,11H |
cas번호 |
2338-71-8 |
분자 구조 |
|
밀도 |
1.385g/cm3 |
비등점 |
342.4°C at 760 mmHg |
굴절 지수 |
1.695 |
인화점 |
160.9°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|