ChemNet > CAS > 23384-72-7 3,4-difluoropropiophenone
23384-72-7 3,4-difluoropropiophenone
| 상품명칭 |
3,4-difluoropropiophenone |
| 별명 |
3',4'-Difluoropropiophenone; 1-(3,4-difluorophenyl)propan-1-one |
| 분자식 |
C9H8F2O |
| 분자량 |
170.156 |
| InChI |
InChI=1/C9H8F2O/c1-2-9(12)6-3-4-7(10)8(11)5-6/h3-5H,2H2,1H3 |
| cas번호 |
23384-72-7 |
| EC번호 |
245-627-2 |
| 분자 구조 |
|
| 밀도 |
1.166g/cm3 |
| 비등점 |
225°C at 760 mmHg |
| 굴절 지수 |
1.472 |
| 인화점 |
84.8°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
