ChemNet > CAS > 2349-58-8 4,5-Diphenyl-2-imidazolethiol
2349-58-8 4,5-Diphenyl-2-imidazolethiol
상품명칭 |
4,5-Diphenyl-2-imidazolethiol |
별명 |
2,3-Diphenyl-1-indenone; 4,5-diphenyl-1,3-dihydro-2H-imidazole-2-thione |
분자식 |
C15H12N2S |
분자량 |
252.3342 |
InChI |
InChI=1/C15H12N2S/c18-15-16-13(11-7-3-1-4-8-11)14(17-15)12-9-5-2-6-10-12/h1-10H,(H2,16,17,18) |
cas번호 |
2349-58-8 |
EC번호 |
219-077-9 |
분자 구조 |
|
밀도 |
1.29g/cm3 |
녹는 점 |
300℃ |
비등점 |
407.5°C at 760 mmHg |
굴절 지수 |
1.724 |
인화점 |
200.3°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|