ChemNet > CAS > 235088-69-4 3,4,5-trifluorobenzylamine
235088-69-4 3,4,5-trifluorobenzylamine
상품명칭 |
3,4,5-trifluorobenzylamine |
별명 |
3,4,5-Trifluorobenzyl amine; 1-(3,4,5-trifluorophenyl)methanamine |
분자식 |
C7H6F3N |
분자량 |
161.1244 |
InChI |
InChI=1/C7H6F3N/c8-5-1-4(3-11)2-6(9)7(5)10/h1-2H,3,11H2 |
cas번호 |
235088-69-4 |
분자 구조 |
|
밀도 |
1.32g/cm3 |
비등점 |
176.3°C at 760 mmHg |
굴절 지수 |
1.48 |
인화점 |
69.4°C |
위험성 표시 |
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|