ChemNet > CAS > 2373-79-7 4-Ethoxycinnamic acid
2373-79-7 4-Ethoxycinnamic acid
상품명칭 |
4-Ethoxycinnamic acid |
별명 |
4-Ethoxycinnamic acid,predominantly trans; (2E)-3-(4-ethoxyphenyl)prop-2-enoic acid; (2Z)-3-(4-ethoxyphenyl)prop-2-enoic acid; (2E)-3-(4-ethoxyphenyl)prop-2-enoate; 3-(4-ETHOXYPHENYL) PROPENOIC ACID |
분자식 |
C11H11O3 |
분자량 |
191.2038 |
InChI |
InChI=1/C11H12O3/c1-2-14-10-6-3-9(4-7-10)5-8-11(12)13/h3-8H,2H2,1H3,(H,12,13)/p-1/b8-5+ |
cas번호 |
2373-79-7 |
분자 구조 |
|
녹는 점 |
195-199℃ |
비등점 |
353.2°C at 760 mmHg |
인화점 |
139.2°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|