ChemNet > CAS > 2386-26-7 ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate
2386-26-7 ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate
상품명칭 |
ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate |
별명 |
3-Acetyl-2,4-dimethyl-5-carbethoxypyrrole; 4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl propanoate |
분자식 |
C11H15NO3 |
분자량 |
209.2417 |
InChI |
InChI=1/C11H15NO3/c1-5-9(14)15-11-6(2)10(8(4)13)7(3)12-11/h12H,5H2,1-4H3 |
cas번호 |
2386-26-7 |
분자 구조 |
|
밀도 |
1.125g/cm3 |
녹는 점 |
139℃ |
비등점 |
348.9°C at 760 mmHg |
굴절 지수 |
1.517 |
인화점 |
164.8°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|