ChemNet > CAS > 2444-68-0 9-Vinylanthracene
2444-68-0 9-Vinylanthracene
상품명칭 |
9-Vinylanthracene |
별명 |
9-Ethenylanthracen; Anthracene, 9-ethenyl- (9CI); 9-ethenylanthracene |
분자식 |
C16H12 |
분자량 |
204.2665 |
InChI |
InChI=1/C16H12/c1-2-14-15-9-5-3-7-12(15)11-13-8-4-6-10-16(13)14/h2-11H,1H2 |
cas번호 |
2444-68-0 |
EC번호 |
219-486-2 |
분자 구조 |
|
밀도 |
1.112g/cm3 |
녹는 점 |
64-66℃ |
비등점 |
377°C at 760 mmHg |
굴절 지수 |
1.724 |
인화점 |
172.4°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|