ChemNet > CAS > 24464-63-9 n-Decylboronic acid
24464-63-9 n-Decylboronic acid
상품명칭 |
n-Decylboronic acid |
별명 |
n-Decaneboronic acid; decylboronic acid |
분자식 |
C10H23BO2 |
분자량 |
186.0994 |
InChI |
InChI=1/C10H23BO2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h12-13H,2-10H2,1H3 |
cas번호 |
24464-63-9 |
분자 구조 |
|
밀도 |
0.883g/cm3 |
비등점 |
297.1°C at 760 mmHg |
굴절 지수 |
1.434 |
인화점 |
133.5°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|