ChemNet > CAS > 2460-59-5 3,5-Dinitro-2-hydroxybenzaldehyde
2460-59-5 3,5-Dinitro-2-hydroxybenzaldehyde
| 상품명칭 |
3,5-Dinitro-2-hydroxybenzaldehyde |
| 별명 |
3,5-Dinitrosalicylaldehyde; 2-hydroxy-3,5-dinitrobenzaldehyde; 2-formyl-4,6-dinitrophenolate |
| 분자식 |
C7H3N2O6 |
| 분자량 |
211.1091 |
| InChI |
InChI=1/C7H4N2O6/c10-3-4-1-5(8(12)13)2-6(7(4)11)9(14)15/h1-3,11H/p-1 |
| cas번호 |
2460-59-5 |
| EC번호 |
219-551-5 |
| 분자 구조 |
|
| 비등점 |
301.5°C at 760 mmHg |
| 인화점 |
133.3°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
