ChemNet > CAS > 25084-14-4 5-Nitro-2-furoylchloride
25084-14-4 5-Nitro-2-furoylchloride
| 상품명칭 |
5-Nitro-2-furoylchloride |
| 별명 |
5-Nitro-2-furoyl chloride; 5-Nitrofuran-2-carbonyl chloride |
| 분자식 |
C5H2ClNO4 |
| 분자량 |
175.5267 |
| InChI |
InChI=1/C5H2ClNO4/c6-5(8)3-1-2-4(11-3)7(9)10/h1-2H |
| cas번호 |
25084-14-4 |
| EC번호 |
246-607-6 |
| 분자 구조 |
|
| 밀도 |
1.588g/cm3 |
| 비등점 |
272.7°C at 760 mmHg |
| 굴절 지수 |
1.552 |
| 인화점 |
118.7°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R34:Causes burns.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
