ChemNet > CAS > 2555-05-7 3-Methyl-2-pyrrolidinone
2555-05-7 3-Methyl-2-pyrrolidinone
상품명칭 |
3-Methyl-2-pyrrolidinone |
별명 |
alpha-Methylbutyrolactam~3-Methyl-2-pyrrolidone; 3-methylpyrrolidin-2-one |
분자식 |
C5H9NO |
분자량 |
99.1311 |
InChI |
InChI=1/C5H9NO/c1-4-2-3-6-5(4)7/h4H,2-3H2,1H3,(H,6,7) |
cas번호 |
2555-05-7 |
EC번호 |
219-865-2 |
분자 구조 |
|
밀도 |
0.979g/cm3 |
비등점 |
240.5°C at 760 mmHg |
굴절 지수 |
1.439 |
인화점 |
127.5°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|