ChemNet > CAS > 2567-29-5 Bromoethylbiphenyl
2567-29-5 Bromoethylbiphenyl
상품명칭 |
Bromoethylbiphenyl |
별명 |
4-Bromoethylbiphenyl; 4-(Bromomethyl)biphenyl; 4-Phenylbenzyl bromide |
분자식 |
C13H11Br |
분자량 |
247.1304 |
InChI |
InChI=1/C13H11Br/c14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-9H,10H2 |
cas번호 |
2567-29-5 |
분자 구조 |
|
밀도 |
1.341g/cm3 |
녹는 점 |
86℃ |
비등점 |
333.4°C at 760 mmHg |
굴절 지수 |
1.605 |
인화점 |
161.3°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|