ChemNet > CAS > 260-94-6 Acridine
260-94-6 Acridine
| 상품명칭 |
Acridine |
| 별명 |
Dibenzo[b,e]pyridine |
| 분자식 |
C13H9N |
| 분자량 |
179.2173 |
| InChI |
InChI=1/C13H9N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-9H |
| cas번호 |
260-94-6 |
| EC번호 |
205-971-6 |
| 분자 구조 |
|
| 밀도 |
1.187g/cm3 |
| 녹는 점 |
105-110℃ |
| 비등점 |
346.7°C at 760 mmHg |
| 굴절 지수 |
1.726 |
| 인화점 |
153.8°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
