ChemNet > CAS > 26378-53-0 2-(2-chlorophenoxy)ethylamine
26378-53-0 2-(2-chlorophenoxy)ethylamine
| 상품명칭 |
2-(2-chlorophenoxy)ethylamine |
| 별명 |
2-Chlorophenoxy-2-ethaneamine; 2-(2-chlorophenoxy)ethanamine |
| 분자식 |
C8H10ClNO |
| 분자량 |
171.6241 |
| InChI |
InChI=1/C8H10ClNO/c9-7-3-1-2-4-8(7)11-6-5-10/h1-4H,5-6,10H2 |
| cas번호 |
26378-53-0 |
| 분자 구조 |
|
| 밀도 |
1.178g/cm3 |
| 비등점 |
266.2°C at 760 mmHg |
| 굴절 지수 |
1.544 |
| 인화점 |
114.8°C |
| 위험성 표시 |
 C:Corrosive;
|
| 리스크 규칙 |
R34:Causes burns.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
