ChemNet > CAS > 2642-98-0 6-Aminochrysene
2642-98-0 6-Aminochrysene
| 상품명칭 |
6-Aminochrysene |
| 별명 |
6-Chrysenamine; chrysen-6-ylamine; chrysen-6-amine |
| 분자식 |
C18H13N |
| 분자량 |
243.3025 |
| InChI |
InChI=1/C18H13N/c19-18-11-17-13-6-2-1-5-12(13)9-10-15(17)14-7-3-4-8-16(14)18/h1-11H,19H2 |
| cas번호 |
2642-98-0 |
| EC번호 |
220-149-7 |
| 분자 구조 |
|
| 밀도 |
1.253g/cm3 |
| 녹는 점 |
206-211℃ |
| 비등점 |
501.2°C at 760 mmHg |
| 굴절 지수 |
1.813 |
| 인화점 |
286.9°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
|
| 보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
