ChemNet > CAS > 2672-58-4 Trimethyl 1,3,5-benzenetricarboxylate
2672-58-4 Trimethyl 1,3,5-benzenetricarboxylate
상품명칭 |
Trimethyl 1,3,5-benzenetricarboxylate |
별명 |
Trimethyl benzene-1,3,5-tricarboxylate; Trimethyl Trimesate; 1,3,5-Benzenetricarboxylic acid trimethyl ester; benzene-1,3,5-triyl triacetate; trimethyl cyclohexane-1,3,5-tricarboxylate |
분자식 |
C12H18O6 |
분자량 |
258.2677 |
InChI |
InChI=1/C12H18O6/c1-16-10(13)7-4-8(11(14)17-2)6-9(5-7)12(15)18-3/h7-9H,4-6H2,1-3H3 |
cas번호 |
2672-58-4 |
EC번호 |
220-215-5 |
분자 구조 |
|
밀도 |
1.177g/cm3 |
녹는 점 |
144-147℃ |
비등점 |
332.8°C at 760 mmHg |
굴절 지수 |
1.464 |
인화점 |
144.1°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|