ChemNet > CAS > 26782-74-1 (S)-2-chloro-3-methylbutyric acid
26782-74-1 (S)-2-chloro-3-methylbutyric acid
| 상품명칭 |
(S)-2-chloro-3-methylbutyric acid |
| 별명 |
(S)-(-)-2-Chloro-3-methylbutyric acid; S-2-chloro-3-methylbutyric acid; (2S)-2-chloro-3-methylbutanoic acid |
| 분자식 |
C5H9ClO2 |
| 분자량 |
136.5768 |
| InChI |
InChI=1/C5H9ClO2/c1-3(2)4(6)5(7)8/h3-4H,1-2H3,(H,7,8)/t4-/m0/s1 |
| cas번호 |
26782-74-1 |
| 분자 구조 |
|
| 밀도 |
1.159g/cm3 |
| 비등점 |
210.3°C at 760 mmHg |
| 굴절 지수 |
1.447 |
| 인화점 |
81°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R34:Causes burns.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
