ChemNet > CAS > 2719-15-5 2-Methyl-4-nitroacetanilide
2719-15-5 2-Methyl-4-nitroacetanilide
| 상품명칭 |
2-Methyl-4-nitroacetanilide |
| 별명 |
N1-(2-Methyl-4-nitrophenyl)acetamide; N-(2-methyl-4-nitrophenyl)acetamide |
| 분자식 |
C9H10N2O3 |
| 분자량 |
194.1873 |
| InChI |
InChI=1/C9H10N2O3/c1-6-5-8(11(13)14)3-4-9(6)10-7(2)12/h3-5H,1-2H3,(H,10,12) |
| cas번호 |
2719-15-5 |
| 분자 구조 |
|
| 밀도 |
1.289g/cm3 |
| 녹는 점 |
198-200℃ |
| 비등점 |
393.3°C at 760 mmHg |
| 굴절 지수 |
1.605 |
| 인화점 |
191.7°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| 보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|
