ChemNet > CAS > 27638-00-2 dilaurin (C12:0)
27638-00-2 dilaurin (C12:0)
상품명칭 |
dilaurin (C12:0) |
별명 |
Dilaurin; Dodecanoic acid, diester with 1,2,3-propanetriol; Glyceryl dilaurate; Lauric acid, diester with glycerol; 3-hydroxypropane-1,2-diyl didodecanoate |
분자식 |
C27H52O5 |
분자량 |
456.6988 |
InChI |
InChI=1/C27H52O5/c1-3-5-7-9-11-13-15-17-19-21-26(29)31-24-25(23-28)32-27(30)22-20-18-16-14-12-10-8-6-4-2/h25,28H,3-24H2,1-2H3 |
cas번호 |
27638-00-2 |
EC번호 |
248-586-9 |
분자 구조 |
|
밀도 |
0.953g/cm3 |
비등점 |
531°C at 760 mmHg |
굴절 지수 |
1.463 |
인화점 |
158°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
|
|