ChemNet > CAS > 2879-42-7 3-Chloro-2,5,6-trifluoropyridine
2879-42-7 3-Chloro-2,5,6-trifluoropyridine
| 상품명칭 |
3-Chloro-2,5,6-trifluoropyridine |
| 분자식 |
C5HClF3N |
| 분자량 |
167.5163 |
| InChI |
InChI=1/C5HClF3N/c6-2-1-3(7)5(9)10-4(2)8/h1H |
| cas번호 |
2879-42-7 |
| 분자 구조 |
|
| 밀도 |
1.562g/cm3 |
| 비등점 |
151.7°C at 760 mmHg |
| 굴절 지수 |
1.457 |
| 인화점 |
45.6°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
