ChemNet > CAS > 288246-16-2 4-bromo-1H-pyrazole-3-carbonitrile
288246-16-2 4-bromo-1H-pyrazole-3-carbonitrile
| 상품명칭 |
4-bromo-1H-pyrazole-3-carbonitrile |
| 별명 |
4-Bromo-3-cyano-1H-pyrazole; 4-bromo-1H-pyrazole-5-carbonitrile; 4-Bromo-2H-pyrazole-3-carbonitrile |
| 분자식 |
C4H2BrN3 |
| 분자량 |
171.9828 |
| InChI |
InChI=1/C4H2BrN3/c5-3-2-7-8-4(3)1-6/h2H,(H,7,8) |
| cas번호 |
288246-16-2 |
| 분자 구조 |
|
| 밀도 |
2.01g/cm3 |
| 녹는 점 |
158℃ |
| 비등점 |
412.4°C at 760 mmHg |
| 굴절 지수 |
1.639 |
| 인화점 |
203.2°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
