ChemNet > CAS > 2905-56-8 1-Benzylpiperidine
2905-56-8 1-Benzylpiperidine
상품명칭 |
1-Benzylpiperidine |
별명 |
N-benzylpiperidine; 1-benzylpiperidine hydrochloride (1:1) |
분자식 |
C12H18ClN |
분자량 |
211.731 |
InChI |
InChI=1/C12H17N.ClH/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;/h1,3-4,7-8H,2,5-6,9-11H2;1H |
cas번호 |
2905-56-8 |
EC번호 |
220-809-4 |
분자 구조 |
|
비등점 |
246.6°C at 760 mmHg |
인화점 |
94°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|