ChemNet > CAS > 2935-63-9 2,3-Dimethylphenoxyacetic acid
2935-63-9 2,3-Dimethylphenoxyacetic acid
| 상품명칭 |
2,3-Dimethylphenoxyacetic acid |
| 별명 |
2,3-Xylyloxyacetic acid; (2,3-dimethylphenoxy)acetate |
| 분자식 |
C10H11O3 |
| 분자량 |
179.1931 |
| InChI |
InChI=1/C10H12O3/c1-7-4-3-5-9(8(7)2)13-6-10(11)12/h3-5H,6H2,1-2H3,(H,11,12)/p-1 |
| cas번호 |
2935-63-9 |
| EC번호 |
220-911-9 |
| 분자 구조 |
|
| 비등점 |
315.2°C at 760 mmHg |
| 인화점 |
124.3°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
