ChemNet > CAS > 2958-87-4 2,3,6-Trichloroquinoxaline
2958-87-4 2,3,6-Trichloroquinoxaline
| 상품명칭 |
2,3,6-Trichloroquinoxaline |
| 별명 |
Quinoxaline, 2,3,6-trichloro-; 4-23-00-01231 (Beilstein Handbook Reference); BRN 0007313; NSC 203052 |
| 분자식 |
C8H3Cl3N2 |
| 분자량 |
233.4818 |
| InChI |
InChI=1/C8H3Cl3N2/c9-4-1-2-5-6(3-4)13-8(11)7(10)12-5/h1-3H |
| cas번호 |
2958-87-4 |
| EC번호 |
220-987-3 |
| 분자 구조 |
|
| 밀도 |
1.6g/cm3 |
| 녹는 점 |
143-148℃ |
| 비등점 |
294.7°C at 760 mmHg |
| 굴절 지수 |
1.677 |
| 인화점 |
160°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
