ChemNet > CAS > 3019-25-8 cyclobutyl methyl ketone
3019-25-8 cyclobutyl methyl ketone
| 상품명칭 |
cyclobutyl methyl ketone |
| 별명 |
Acetylcyclobutane; 1-cyclobutylethanone
; 1-cyclobutylethanone |
| 분자식 |
C6H10O |
| 분자량 |
98.143 |
| InChI |
InChI=1/C6H10O/c1-5(7)6-3-2-4-6/h6H,2-4H2,1H3 |
| cas번호 |
3019-25-8 |
| EC번호 |
221-163-6 |
| 분자 구조 |
|
| 밀도 |
0.96g/cm3 |
| 비등점 |
137.5°C at 760 mmHg |
| 굴절 지수 |
1.453 |
| 인화점 |
32.3°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R10:Flammable.;
|
| 보안 규칙 |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
