ChemNet > CAS > 302901-02-6 1-(2,5-dichloro-4-nitrophenyl)-2,5-dimethyl-1H-pyrrole
302901-02-6 1-(2,5-dichloro-4-nitrophenyl)-2,5-dimethyl-1H-pyrrole
상품명칭 |
1-(2,5-dichloro-4-nitrophenyl)-2,5-dimethyl-1H-pyrrole |
분자식 |
C12H10Cl2N2O2 |
분자량 |
285.126 |
InChI |
InChI=1/C12H10Cl2N2O2/c1-7-3-4-8(2)15(7)11-5-10(14)12(16(17)18)6-9(11)13/h3-6H,1-2H3 |
cas번호 |
302901-02-6 |
분자 구조 |
|
밀도 |
1.41g/cm3 |
녹는 점 |
82℃ |
비등점 |
410.6°C at 760 mmHg |
굴절 지수 |
1.623 |
인화점 |
202.1°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|