ChemNet > CAS > 3033-82-7 8-Chloroquinaldine
3033-82-7 8-Chloroquinaldine
상품명칭 |
8-Chloroquinaldine |
별명 |
8-Chloro-2-methylquinoline; 2-Methyl-8-chloroquinoline |
분자식 |
C10H8ClN |
분자량 |
177.6302 |
InChI |
InChI=1/C10H8ClN/c1-7-5-6-8-3-2-4-9(11)10(8)12-7/h2-6H,1H3 |
cas번호 |
3033-82-7 |
분자 구조 |
|
밀도 |
1.225g/cm3 |
녹는 점 |
64-66℃ |
비등점 |
278.2°C at 760 mmHg |
굴절 지수 |
1.634 |
인화점 |
148.7°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|