ChemNet > CAS > 3048-64-4 5-Vinyl-2-norbornene
3048-64-4 5-Vinyl-2-norbornene
| 상품명칭 |
5-Vinyl-2-norbornene |
| 별명 |
5-Vinyl-2-norbornene,mixture of endo and exo; Vinylnorbornene; 2-ethenylbicyclo[2.2.1]hept-1-ene; 5-ethenylbicyclo[2.2.1]hept-1-ene |
| 분자량 |
C9H8 |
| InChI |
InChI=1/C9H12/c1-2-8-5-7-3-4-9(8)6-7/h2-3,8-9H,1,4-6H2 |
| cas번호 |
3048-64-4 |
| EC번호 |
221-259-8 |
| 분자 구조 |
|
| 밀도 |
1.612 |
| 녹는 점 |
-80℃ |
| 비등점 |
137.909°C |
| 굴절 지수 |
144.1732 |
| 인화점 |
1.189g/cm3 |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R10:Flammable.;
R20:Harmful by inhalation.;
R36/38:Irritating to eyes and skin.;
|
| 보안 규칙 |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
