ChemNet > CAS > 3084-53-5 Trimethylsulfoniumbromide
3084-53-5 Trimethylsulfoniumbromide
상품명칭 |
Trimethylsulfoniumbromide |
별명 |
Trimethylsulfonium bromide; Trimethylsulphonium bromide; trimethylsulfonium; Trimethyl-sulfoniubromide; Sulfonium, trimethyl-, bromide |
분자식 |
C3H9BrS |
분자량 |
157.0726 |
InChI |
InChI=1/C3H9S.BrH/c1-4(2)3;/h1-3H3;1H/q+1;/p-1 |
cas번호 |
3084-53-5 |
분자 구조 |
|
녹는 점 |
203℃ |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|