ChemNet > CAS > 30955-94-3 2-Acetyl-5-iodothiophene
30955-94-3 2-Acetyl-5-iodothiophene
상품명칭 |
2-Acetyl-5-iodothiophene |
별명 |
NSC 80387; 1-(5-iodothiophen-2-yl)ethanone |
분자식 |
C6H5IOS |
분자량 |
252.0728 |
InChI |
InChI=1/C6H5IOS/c1-4(8)5-2-3-6(7)9-5/h2-3H,1H3 |
cas번호 |
30955-94-3 |
분자 구조 |
|
밀도 |
1.902g/cm3 |
비등점 |
306.2°C at 760 mmHg |
굴절 지수 |
1.637 |
인화점 |
139°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|