ChemNet > CAS > 30989-81-2 3-amino-2-methylacrylaldehyde
30989-81-2 3-amino-2-methylacrylaldehyde
상품명칭 |
3-amino-2-methylacrylaldehyde |
별명 |
(2E)-3-amino-2-methylprop-2-enal |
분자식 |
C4H7NO |
분자량 |
85.1045 |
InChI |
InChI=1/C4H7NO/c1-4(2-5)3-6/h2-3H,5H2,1H3/b4-2+ |
cas번호 |
30989-81-2 |
분자 구조 |
|
밀도 |
0.956g/cm3 |
녹는 점 |
111℃ |
비등점 |
278.5°C at 760 mmHg |
굴절 지수 |
1.456 |
인화점 |
122.3°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|